About 7-ethylimidazo[1,2-a]pyridine
7-ethylimidazo[1,2-a]pyridine (PubChem CID 18184463) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 7-ethylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 7-ethylimidazo[1,2-a]pyridine |
| PubChem CID | 18184463 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 7-ethylimidazo[1,2-a]pyridine |
| SMILES | CCc1ccn2ccnc2c1 |
| InChI | InChI=1S/C9H10N2/c1-2-8-3-5-11-6-4-10-9(11)7-8/h3-7H,2H2,1H3 |
| InChIKey | QXOSNCLWMUYMDB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylimidazo[1,2-a]pyridine?
The IUPAC name of 7-ethylimidazo[1,2-a]pyridine (CID 18184463) is 7-ethylimidazo[1,2-a]pyridine.
What is the SMILES notation for 7-ethylimidazo[1,2-a]pyridine?
The canonical SMILES for 7-ethylimidazo[1,2-a]pyridine is CCc1ccn2ccnc2c1.
What is the InChIKey of 7-ethylimidazo[1,2-a]pyridine?
The InChIKey is QXOSNCLWMUYMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-2-8-3-5-11-6-4-10-9(11)7-8/h3-7H,2H2,1H3.
What are the key properties of 7-ethylimidazo[1,2-a]pyridine?
7-ethylimidazo[1,2-a]pyridine has a molecular weight of 146.19 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylimidazo[1,2-a]pyridine is sourced from PubChem (CID 18184463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).