C13H18N2 — CID 170374911
7-hexan-3-ylimidazo[1,2-a]pyridine (PubChem CID 170374911) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 7-hexan-3-ylimidazo[1,2-a]pyridine.
| Compound Name | 7-hexan-3-ylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 170374911 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 7-hexan-3-ylimidazo[1,2-a]pyridine |
| SMILES | CCCC(CC)c1ccn2ccnc2c1 |
| InChI | InChI=1S/C13H18N2/c1-3-5-11(4-2)12-6-8-15-9-7-14-13(15)10-12/h6-11H,3-5H2,1-2H3 |
| InChIKey | LTPQBVAHLJQDBU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |