C14H17N3O3 — CID 119192037
2-(imidazo[1,2-a]pyridine-6-carbonylamino)-2-methylpentanoic acid (PubChem CID 119192037) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-(imidazo[1,2-a]pyridine-6-carbonylamino)-2-methylpentanoic acid.
| Compound Name | 2-(imidazo[1,2-a]pyridine-6-carbonylamino)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 119192037 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-(imidazo[1,2-a]pyridine-6-carbonylamino)-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)c1ccc2nccn2c1)C(=O)O |
| InChI | InChI=1S/C14H17N3O3/c1-3-6-14(2,13(19)20)16-12(18)10-4-5-11-15-7-8-17(11)9-10/h4-5,7-9H,3,6H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | HZQMFFBYZVZGFV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |