C20H15N5O — CID 52880425
N-(4-phenyldiazenylphenyl)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 52880425) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(4-phenyldiazenylphenyl)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-(4-phenyldiazenylphenyl)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 52880425 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(4-phenyldiazenylphenyl)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1)c1ccc2nccn2c1 |
| InChI | InChI=1S/C20H15N5O/c26-20(15-6-11-19-21-12-13-25(19)14-15)22-16-7-9-18(10-8-16)24-23-17-4-2-1-3-5-17/h1-14H,(H,22,26)/b24-23+ |
| InChIKey | KKWMCCFOEOZDRJ-WCWDXBQESA-N |
| XLogP | 5.00 |
| TPSA | 71.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|