C17H17N3O — CID 110704012
N-(3-phenylpropyl)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 110704012) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(3-phenylpropyl)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-(3-phenylpropyl)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 110704012 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-(3-phenylpropyl)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccc2nccn2c1 |
| InChI | InChI=1S/C17H17N3O/c21-17(15-8-9-16-18-11-12-20(16)13-15)19-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-13H,4,7,10H2,(H,19,21) |
| InChIKey | CTWSASLKGFLKOM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|