C44H37N2O2P — CID 10349359
ethyl (Z)-3-[5-(2,2-diphenylethenylideneamino)-2-methylphenyl]-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate (PubChem CID 10349359) has the molecular formula C44H37N2O2P and a molecular weight of 656.77 g/mol. Its IUPAC name is ethyl (Z)-3-[5-(2,2-diphenylethenylideneamino)-2-methylphenyl]-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[5-(2,2-diphenylethenylideneamino)-2-methylphenyl]-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate |
|---|---|
| PubChem CID | 10349359 |
| Molecular Formula | C44H37N2O2P |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | ethyl (Z)-3-[5-(2,2-diphenylethenylideneamino)-2-methylphenyl]-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1cc(N=C=C(c2ccccc2)c2ccccc2)ccc1C)N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H37N2O2P/c1-3-48-44(47)43(46-49(39-23-13-6-14-24-39,40-25-15-7-16-26-40)41-27-17-8-18-28-41)32-37-31-38(30-29-34(37)2)45-33-42(35-19-9-4-10-20-35)36-21-11-5-12-22-36/h4-32H,3H2,1-2H3/b43-32- |
| InChIKey | HETCLLUCCWFMLZ-SLSZCLEPSA-N |
| XLogP | 9.51 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|