C36H30NO4P — CID 172907473
ethyl 7-hydroxy-4-phenyl-2-[(triphenyl-λ5-phosphanylidene)amino]-4H-chromene-3-carboxylate (PubChem CID 172907473) has the molecular formula C36H30NO4P and a molecular weight of 571.61 g/mol. Its IUPAC name is ethyl 7-hydroxy-4-phenyl-2-[(triphenyl-λ5-phosphanylidene)amino]-4H-chromene-3-carboxylate.
| Compound Name | ethyl 7-hydroxy-4-phenyl-2-[(triphenyl-λ5-phosphanylidene)amino]-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 172907473 |
| Molecular Formula | C36H30NO4P |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | ethyl 7-hydroxy-4-phenyl-2-[(triphenyl-λ5-phosphanylidene)amino]-4H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)Oc2cc(O)ccc2C1c1ccccc1 |
| InChI | InChI=1S/C36H30NO4P/c1-2-40-36(39)34-33(26-15-7-3-8-16-26)31-24-23-27(38)25-32(31)41-35(34)37-42(28-17-9-4-10-18-28,29-19-11-5-12-20-29)30-21-13-6-14-22-30/h3-25,33,38H,2H2,1H3 |
| InChIKey | VDWXMIYOISGARW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|