C23H19IO6 — CID 163695863
(2-hydroxy-3-iodopropyl) 3-(3,6-dihydroxy-9H-xanthen-9-yl)benzoate (PubChem CID 163695863) has the molecular formula C23H19IO6 and a molecular weight of 518.30 g/mol. Its IUPAC name is (2-hydroxy-3-iodopropyl) 3-(3,6-dihydroxy-9H-xanthen-9-yl)benzoate.
| Compound Name | (2-hydroxy-3-iodopropyl) 3-(3,6-dihydroxy-9H-xanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 163695863 |
| Molecular Formula | C23H19IO6 |
| Molecular Weight | 518.30 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | (2-hydroxy-3-iodopropyl) 3-(3,6-dihydroxy-9H-xanthen-9-yl)benzoate |
| SMILES | O=C(OCC(O)CI)c1cccc(C2c3ccc(O)cc3Oc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C23H19IO6/c24-11-17(27)12-29-23(28)14-3-1-2-13(8-14)22-18-6-4-15(25)9-20(18)30-21-10-16(26)5-7-19(21)22/h1-10,17,22,25-27H,11-12H2 |
| InChIKey | JWWWNAORADNMJO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|