C23H22N2O3 — CID 70946656
methyl 3-[3,6-bis(methylamino)-9H-xanthen-9-yl]benzoate (PubChem CID 70946656) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 3-[3,6-bis(methylamino)-9H-xanthen-9-yl]benzoate.
| Compound Name | methyl 3-[3,6-bis(methylamino)-9H-xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 70946656 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | methyl 3-[3,6-bis(methylamino)-9H-xanthen-9-yl]benzoate |
| SMILES | CNc1ccc2c(c1)Oc1cc(NC)ccc1C2c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H22N2O3/c1-24-16-7-9-18-20(12-16)28-21-13-17(25-2)8-10-19(21)22(18)14-5-4-6-15(11-14)23(26)27-3/h4-13,22,24-25H,1-3H3 |
| InChIKey | GEOPWESZANCHJZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|