methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate

C16H14O4 — CID 167596857

IUPACmethyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate
SMILESCOC(=O)c1cccc(C2COc3ccccc3O2)c1
InChIInChI=1S/C16H14O4/c1-18-16(17)12-6-4-5-11(9-12)15-10-19-13-7-2-3-8-14(13)20-15/h2-9,15H,10H2,1H3
InChIKeyRCYJBCQETREJLY-UHFFFAOYSA-N
MW270.28 g/mol
LogP2.99
Rot. Bonds2

About methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate

methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate (PubChem CID 167596857) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate.

Molecular Properties

Compound Namemethyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate
PubChem CID167596857
Molecular FormulaC16H14O4
Molecular Weight270.28 g/mol
Exact Mass270.09
IUPAC Namemethyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate
SMILESCOC(=O)c1cccc(C2COc3ccccc3O2)c1
InChIInChI=1S/C16H14O4/c1-18-16(17)12-6-4-5-11(9-12)15-10-19-13-7-2-3-8-14(13)20-15/h2-9,15H,10H2,1H3
InChIKeyRCYJBCQETREJLY-UHFFFAOYSA-N
XLogP2.99
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.28
LogP ≤ 52.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate?
The IUPAC name of methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate (CID 167596857) is methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate.
What is the SMILES notation for methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate?
The canonical SMILES for methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate is COC(=O)c1cccc(C2COc3ccccc3O2)c1.
What is the InChIKey of methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate?
The InChIKey is RCYJBCQETREJLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4/c1-18-16(17)12-6-4-5-11(9-12)15-10-19-13-7-2-3-8-14(13)20-15/h2-9,15H,10H2,1H3.
What are the key properties of methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate?
methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate has a molecular weight of 270.28 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dihydro-1,4-benzodioxin-3-yl)benzoate is sourced from PubChem (CID 167596857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).