C21H16O5 — CID 15100211
methyl 2-(3,6-dihydroxy-9H-xanthen-9-yl)benzoate (PubChem CID 15100211) has the molecular formula C21H16O5 and a molecular weight of 348.35 g/mol. Its IUPAC name is methyl 2-(3,6-dihydroxy-9H-xanthen-9-yl)benzoate.
| Compound Name | methyl 2-(3,6-dihydroxy-9H-xanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 15100211 |
| Molecular Formula | C21H16O5 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | methyl 2-(3,6-dihydroxy-9H-xanthen-9-yl)benzoate |
| SMILES | COC(=O)c1ccccc1C1c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C21H16O5/c1-25-21(24)15-5-3-2-4-14(15)20-16-8-6-12(22)10-18(16)26-19-11-13(23)7-9-17(19)20/h2-11,20,22-23H,1H3 |
| InChIKey | XKCJYOACZDHRBU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |