C29H28NO2PS — CID 10939844
ethyl 2-[(triphenyl-λ5-phosphanylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 10939844) has the molecular formula C29H28NO2PS and a molecular weight of 485.59 g/mol. Its IUPAC name is ethyl 2-[(triphenyl-λ5-phosphanylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(triphenyl-λ5-phosphanylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 10939844 |
| Molecular Formula | C29H28NO2PS |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | ethyl 2-[(triphenyl-λ5-phosphanylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C29H28NO2PS/c1-2-32-29(31)27-25-20-12-13-21-26(25)34-28(27)30-33(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-11,14-19H,2,12-13,20-21H2,1H3 |
| InChIKey | SSANPYLATMUYCD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|