C23H24N2O5S2 — CID 127045468
ethyl (2Z)-2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)imino]-4-oxo-3-phenyl-1,3-thiazolidine-5-carboxylate (PubChem CID 127045468) has the molecular formula C23H24N2O5S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)imino]-4-oxo-3-phenyl-1,3-thiazolidine-5-carboxylate.
| Compound Name | ethyl (2Z)-2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)imino]-4-oxo-3-phenyl-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 127045468 |
| Molecular Formula | C23H24N2O5S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | ethyl (2Z)-2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)imino]-4-oxo-3-phenyl-1,3-thiazolidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(/N=C2\SC(C(=O)OCC)C(=O)N2c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C23H24N2O5S2/c1-3-29-21(27)17-15-12-8-9-13-16(15)31-19(17)24-23-25(14-10-6-5-7-11-14)20(26)18(32-23)22(28)30-4-2/h5-7,10-11,18H,3-4,8-9,12-13H2,1-2H3/b24-23- |
| InChIKey | AFXWTOMFANIZOZ-VHXPQNKSSA-N |
| XLogP | 4.50 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|