C24H33NO4S — CID 23967161
ethyl 2-[(2,6-dioxocyclohexyl)methylideneamino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate (PubChem CID 23967161) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is ethyl 2-[(2,6-dioxocyclohexyl)methylideneamino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2,6-dioxocyclohexyl)methylideneamino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23967161 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl 2-[(2,6-dioxocyclohexyl)methylideneamino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=CC2C(=O)CCCC2=O)sc2c1CCCCCCCCCC2 |
| InChI | InChI=1S/C24H33NO4S/c1-2-29-24(28)22-17-12-9-7-5-3-4-6-8-10-15-21(17)30-23(22)25-16-18-19(26)13-11-14-20(18)27/h16,18H,2-15H2,1H3 |
| InChIKey | DLJBEFGWFTYRMO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|