C30H28N2O2S — CID 3133412
ethyl 2-[[phenyl-(2-phenylanilino)methylidene]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3133412) has the molecular formula C30H28N2O2S and a molecular weight of 480.63 g/mol. Its IUPAC name is ethyl 2-[[phenyl-(2-phenylanilino)methylidene]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[phenyl-(2-phenylanilino)methylidene]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3133412 |
| Molecular Formula | C30H28N2O2S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | ethyl 2-[[phenyl-(2-phenylanilino)methylidene]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=C(Nc2ccccc2-c2ccccc2)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C30H28N2O2S/c1-2-34-30(33)27-24-18-10-12-20-26(24)35-29(27)32-28(22-15-7-4-8-16-22)31-25-19-11-9-17-23(25)21-13-5-3-6-14-21/h3-9,11,13-17,19H,2,10,12,18,20H2,1H3,(H,31,32) |
| InChIKey | WZFMMYJIMVJSJP-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|