C12H11IO3 — CID 11771851
5-iodo-2,2-dimethyl-6-phenyl-1,3-dioxin-4-one (PubChem CID 11771851) has the molecular formula C12H11IO3 and a molecular weight of 330.12 g/mol. Its IUPAC name is 5-iodo-2,2-dimethyl-6-phenyl-1,3-dioxin-4-one.
| Compound Name | 5-iodo-2,2-dimethyl-6-phenyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11771851 |
| Molecular Formula | C12H11IO3 |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 5-iodo-2,2-dimethyl-6-phenyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C(I)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C12H11IO3/c1-12(2)15-10(9(13)11(14)16-12)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | FRGKDSWTHBGCAE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|