C18H26O — CID 20652960
2,2,3,3,4,4,5-heptamethyl-6-phenylpyran (PubChem CID 20652960) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptamethyl-6-phenylpyran.
| Compound Name | 2,2,3,3,4,4,5-heptamethyl-6-phenylpyran |
|---|---|
| PubChem CID | 20652960 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2,2,3,3,4,4,5-heptamethyl-6-phenylpyran |
| SMILES | CC1=C(c2ccccc2)OC(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C18H26O/c1-13-15(14-11-9-8-10-12-14)19-18(6,7)17(4,5)16(13,2)3/h8-12H,1-7H3 |
| InChIKey | ZBTSNXDBVFNSGH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |