C40H44B2O4-2 — CID 171341430
2,2,3,3,10,10,11,11-octamethyl-6,7,13,14-tetraphenyl-1,4,9,12-tetraoxa-5,8-diboranuidadispiro[4.2.48.25]tetradeca-6,13-diene (PubChem CID 171341430) has the molecular formula C40H44B2O4-2 and a molecular weight of 610.41 g/mol. Its IUPAC name is 2,2,3,3,10,10,11,11-octamethyl-6,7,13,14-tetraphenyl-1,4,9,12-tetraoxa-5,8-diboranuidadispiro[4.2.48.25]tetradeca-6,13-diene.
| Compound Name | 2,2,3,3,10,10,11,11-octamethyl-6,7,13,14-tetraphenyl-1,4,9,12-tetraoxa-5,8-diboranuidadispiro[4.2.48.25]tetradeca-6,13-diene |
|---|---|
| PubChem CID | 171341430 |
| Molecular Formula | C40H44B2O4-2 |
| Molecular Weight | 610.41 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | 2,2,3,3,10,10,11,11-octamethyl-6,7,13,14-tetraphenyl-1,4,9,12-tetraoxa-5,8-diboranuidadispiro[4.2.48.25]tetradeca-6,13-diene |
| SMILES | CC1(C)O[B-]2(OC1(C)C)C(c1ccccc1)=C(c1ccccc1)[B-]1(OC(C)(C)C(C)(C)O1)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C40H44B2O4/c1-37(2)38(3,4)44-41(43-37)33(29-21-13-9-14-22-29)35(31-25-17-11-18-26-31)42(45-39(5,6)40(7,8)46-42)36(32-27-19-12-20-28-32)34(41)30-23-15-10-16-24-30/h9-28H,1-8H3/q-2 |
| InChIKey | DWXVTQZQEWLNKM-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.41 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|