C28H30BN2O2- — CID 164686753
(1'R,2'R)-4,4,5,5-tetramethyl-4',12'-diphenylspiro[1,3-dioxa-2-boranuidacyclopentane-2,8'-7,9-diaza-8-boranuidatricyclo[7.4.0.02,7]trideca-3,5,10,12-tetraene] (PubChem CID 164686753) has the molecular formula C28H30BN2O2- and a molecular weight of 437.37 g/mol. Its IUPAC name is (1'R,2'R)-4,4,5,5-tetramethyl-4',12'-diphenylspiro[1,3-dioxa-2-boranuidacyclopentane-2,8'-7,9-diaza-8-boranuidatricyclo[7.4.0.02,7]trideca-3,5,10,12-tetraene].
| Compound Name | (1'R,2'R)-4,4,5,5-tetramethyl-4',12'-diphenylspiro[1,3-dioxa-2-boranuidacyclopentane-2,8'-7,9-diaza-8-boranuidatricyclo[7.4.0.02,7]trideca-3,5,10,12-tetraene] |
|---|---|
| PubChem CID | 164686753 |
| Molecular Formula | C28H30BN2O2- |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (1'R,2'R)-4,4,5,5-tetramethyl-4',12'-diphenylspiro[1,3-dioxa-2-boranuidacyclopentane-2,8'-7,9-diaza-8-boranuidatricyclo[7.4.0.02,7]trideca-3,5,10,12-tetraene] |
| SMILES | CC1(C)O[B-]2(OC1(C)C)N1C=CC(c3ccccc3)=C[C@@H]1[C@H]1C=C(c3ccccc3)C=CN12 |
| InChI | InChI=1S/C28H30BN2O2/c1-27(2)28(3,4)33-29(32-27)30-17-15-23(21-11-7-5-8-12-21)19-25(30)26-20-24(16-18-31(26)29)22-13-9-6-10-14-22/h5-20,25-26H,1-4H3/q-1/t25-,26-/m1/s1 |
| InChIKey | KQAJGNUOMRTOQK-CLJLJLNGSA-N |
| XLogP | 5.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|