C17H14O — CID 18671215
2,4-diphenyl-2H-pyran (PubChem CID 18671215) has the molecular formula C17H14O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2,4-diphenyl-2H-pyran.
| Compound Name | 2,4-diphenyl-2H-pyran |
|---|---|
| PubChem CID | 18671215 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2,4-diphenyl-2H-pyran |
| SMILES | C1=CC(c2ccccc2)=CC(c2ccccc2)O1 |
| InChI | InChI=1S/C17H14O/c1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15/h1-13,17H |
| InChIKey | LGENTIORMJQGHG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |