C13H20BO2- — CID 10751693
2,4,4,5,5-pentamethyl-2-phenyl-1,3-dioxa-2-boranuidacyclopentane (PubChem CID 10751693) has the molecular formula C13H20BO2- and a molecular weight of 219.11 g/mol. Its IUPAC name is 2,4,4,5,5-pentamethyl-2-phenyl-1,3-dioxa-2-boranuidacyclopentane.
| Compound Name | 2,4,4,5,5-pentamethyl-2-phenyl-1,3-dioxa-2-boranuidacyclopentane |
|---|---|
| PubChem CID | 10751693 |
| Molecular Formula | C13H20BO2- |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2,4,4,5,5-pentamethyl-2-phenyl-1,3-dioxa-2-boranuidacyclopentane |
| SMILES | C[B-]1(c2ccccc2)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H20BO2/c1-12(2)13(3,4)16-14(5,15-12)11-9-7-6-8-10-11/h6-10H,1-5H3/q-1 |
| InChIKey | FPZOSSPTRNOMNC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|