C22H28BNO2 — CID 139118172
(7S,9Z)-9-benzylidene-2,2,3,3-tetramethyl-7-phenyl-1,4-dioxa-6-azonia-5-boranuidaspiro[4.4]nonane (PubChem CID 139118172) has the molecular formula C22H28BNO2 and a molecular weight of 349.28 g/mol. Its IUPAC name is (7S,9Z)-9-benzylidene-2,2,3,3-tetramethyl-7-phenyl-1,4-dioxa-6-azonia-5-boranuidaspiro[4.4]nonane.
| Compound Name | (7S,9Z)-9-benzylidene-2,2,3,3-tetramethyl-7-phenyl-1,4-dioxa-6-azonia-5-boranuidaspiro[4.4]nonane |
|---|---|
| PubChem CID | 139118172 |
| Molecular Formula | C22H28BNO2 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (7S,9Z)-9-benzylidene-2,2,3,3-tetramethyl-7-phenyl-1,4-dioxa-6-azonia-5-boranuidaspiro[4.4]nonane |
| SMILES | CC1(C)O[B-]2([NH2+][C@H](c3ccccc3)C/C2=C\c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C22H28BNO2/c1-21(2)22(3,4)26-23(25-21)19(15-17-11-7-5-8-12-17)16-20(24-23)18-13-9-6-10-14-18/h5-15,20H,16,24H2,1-4H3/b19-15+/t20-/m0/s1 |
| InChIKey | RKQSHVKUBACIRR-ZAQQZEBGSA-N |
| XLogP | 3.86 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|