C11H16ClN — CID 139115561
(2R,5S)-2-methyl-5-phenylpyrrolidin-1-ium chloride (PubChem CID 139115561) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is (2R,5S)-2-methyl-5-phenylpyrrolidin-1-ium chloride.
| Compound Name | (2R,5S)-2-methyl-5-phenylpyrrolidin-1-ium chloride |
|---|---|
| PubChem CID | 139115561 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2R,5S)-2-methyl-5-phenylpyrrolidin-1-ium chloride |
| SMILES | C[C@@H]1CC[C@@H](c2ccccc2)[NH2+]1.[Cl-] |
| InChI | InChI=1S/C11H15N.ClH/c1-9-7-8-11(12-9)10-5-3-2-4-6-10;/h2-6,9,11-12H,7-8H2,1H3;1H/t9-,11+;/m1./s1 |
| InChIKey | ASPBFAZIRKFWLN-XQKZEKTMSA-N |
| XLogP | -1.52 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |