C25H28NO+ — CID 7281626
(2S,3R,4R,6S)-4-benzyl-3-methyl-2,6-diphenylpiperidin-1-ium-4-ol (PubChem CID 7281626) has the molecular formula C25H28NO+ and a molecular weight of 358.51 g/mol. Its IUPAC name is (2S,3R,4R,6S)-4-benzyl-3-methyl-2,6-diphenylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3R,4R,6S)-4-benzyl-3-methyl-2,6-diphenylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7281626 |
| Molecular Formula | C25H28NO+ |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (2S,3R,4R,6S)-4-benzyl-3-methyl-2,6-diphenylpiperidin-1-ium-4-ol |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)[NH2+][C@H](c2ccccc2)C[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C25H27NO/c1-19-24(22-15-9-4-10-16-22)26-23(21-13-7-3-8-14-21)18-25(19,27)17-20-11-5-2-6-12-20/h2-16,19,23-24,26-27H,17-18H2,1H3/p+1/t19-,23+,24+,25-/m1/s1 |
| InChIKey | NDHOPVCXDQDCPC-LJYZBVLISA-O |
| XLogP | 4.05 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |