C25H27NO — CID 98713917
(2R,3R,4S,6S)-4-benzyl-3-methyl-2,6-diphenylpiperidin-4-ol (PubChem CID 98713917) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (2R,3R,4S,6S)-4-benzyl-3-methyl-2,6-diphenylpiperidin-4-ol.
| Compound Name | (2R,3R,4S,6S)-4-benzyl-3-methyl-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 98713917 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2R,3R,4S,6S)-4-benzyl-3-methyl-2,6-diphenylpiperidin-4-ol |
| SMILES | C[C@@H]1[C@H](c2ccccc2)N[C@H](c2ccccc2)C[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C25H27NO/c1-19-24(22-15-9-4-10-16-22)26-23(21-13-7-3-8-14-21)18-25(19,27)17-20-11-5-2-6-12-20/h2-16,19,23-24,26-27H,17-18H2,1H3/t19-,23+,24-,25+/m1/s1 |
| InChIKey | NDHOPVCXDQDCPC-MNVNNWCQSA-N |
| XLogP | 5.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |