C25H26ClNO — CID 1333836
(2R,3R,4S,6S)-4-[(2-chlorophenyl)methyl]-3-methyl-2,6-diphenylpiperidin-4-ol (PubChem CID 1333836) has the molecular formula C25H26ClNO and a molecular weight of 391.94 g/mol. Its IUPAC name is (2R,3R,4S,6S)-4-[(2-chlorophenyl)methyl]-3-methyl-2,6-diphenylpiperidin-4-ol.
| Compound Name | (2R,3R,4S,6S)-4-[(2-chlorophenyl)methyl]-3-methyl-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 1333836 |
| Molecular Formula | C25H26ClNO |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2R,3R,4S,6S)-4-[(2-chlorophenyl)methyl]-3-methyl-2,6-diphenylpiperidin-4-ol |
| SMILES | C[C@@H]1[C@H](c2ccccc2)N[C@H](c2ccccc2)C[C@@]1(O)Cc1ccccc1Cl |
| InChI | InChI=1S/C25H26ClNO/c1-18-24(20-12-6-3-7-13-20)27-23(19-10-4-2-5-11-19)17-25(18,28)16-21-14-8-9-15-22(21)26/h2-15,18,23-24,27-28H,16-17H2,1H3/t18-,23+,24-,25+/m1/s1 |
| InChIKey | BEWVWNGYSGPFME-DUPGQGGVSA-N |
| XLogP | 5.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |