C26H29NO — CID 7243060
(2S,3S,5S,6S)-4-benzyl-3,5-dimethyl-2,6-diphenylpiperidin-4-ol (PubChem CID 7243060) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is (2S,3S,5S,6S)-4-benzyl-3,5-dimethyl-2,6-diphenylpiperidin-4-ol.
| Compound Name | (2S,3S,5S,6S)-4-benzyl-3,5-dimethyl-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 7243060 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (2S,3S,5S,6S)-4-benzyl-3,5-dimethyl-2,6-diphenylpiperidin-4-ol |
| SMILES | C[C@H]1[C@@H](c2ccccc2)N[C@H](c2ccccc2)[C@H](C)C1(O)Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO/c1-19-24(22-14-8-4-9-15-22)27-25(23-16-10-5-11-17-23)20(2)26(19,28)18-21-12-6-3-7-13-21/h3-17,19-20,24-25,27-28H,18H2,1-2H3/t19-,20-,24-,25-/m0/s1 |
| InChIKey | YRMXCILLNZAXNX-WNLYKICVSA-N |
| XLogP | 5.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |