C27H31NO — CID 7358357
(2R,3S,5S,6S)-4-benzyl-1,3,5-trimethyl-2,6-diphenylpiperidin-4-ol (PubChem CID 7358357) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is (2R,3S,5S,6S)-4-benzyl-1,3,5-trimethyl-2,6-diphenylpiperidin-4-ol.
| Compound Name | (2R,3S,5S,6S)-4-benzyl-1,3,5-trimethyl-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 7358357 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (2R,3S,5S,6S)-4-benzyl-1,3,5-trimethyl-2,6-diphenylpiperidin-4-ol |
| SMILES | C[C@H]1[C@@H](c2ccccc2)N(C)[C@@H](c2ccccc2)[C@H](C)C1(O)Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO/c1-20-25(23-15-9-5-10-16-23)28(3)26(24-17-11-6-12-18-24)21(2)27(20,29)19-22-13-7-4-8-14-22/h4-18,20-21,25-26,29H,19H2,1-3H3/t20-,21-,25-,26+,27?/m0/s1 |
| InChIKey | XYXSWNLJRUZOJN-CYTDPQRLSA-N |
| XLogP | 5.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |