C23H31NO — CID 124823280
(2R,3R,5R,6R)-1,3,5-trimethyl-2,6-diphenyl-4-propylpiperidin-4-ol (PubChem CID 124823280) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (2R,3R,5R,6R)-1,3,5-trimethyl-2,6-diphenyl-4-propylpiperidin-4-ol.
| Compound Name | (2R,3R,5R,6R)-1,3,5-trimethyl-2,6-diphenyl-4-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 124823280 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (2R,3R,5R,6R)-1,3,5-trimethyl-2,6-diphenyl-4-propylpiperidin-4-ol |
| SMILES | CCCC1(O)[C@H](C)[C@H](c2ccccc2)N(C)[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C23H31NO/c1-5-16-23(25)17(2)21(19-12-8-6-9-13-19)24(4)22(18(23)3)20-14-10-7-11-15-20/h6-15,17-18,21-22,25H,5,16H2,1-4H3/t17-,18-,21-,22-/m1/s1 |
| InChIKey | QYKFGQQFZQYMFW-MCEIDBOGSA-N |
| XLogP | 5.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |