C23H27NO2 — CID 100969299
ethyl (4R,5R,7S)-4-methyl-5,7-diphenyl-6-azaspiro[2.5]octane-2-carboxylate (PubChem CID 100969299) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is ethyl (4R,5R,7S)-4-methyl-5,7-diphenyl-6-azaspiro[2.5]octane-2-carboxylate.
| Compound Name | ethyl (4R,5R,7S)-4-methyl-5,7-diphenyl-6-azaspiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 100969299 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | ethyl (4R,5R,7S)-4-methyl-5,7-diphenyl-6-azaspiro[2.5]octane-2-carboxylate |
| SMILES | CCOC(=O)C1CC12C[C@@H](c1ccccc1)N[C@@H](c1ccccc1)[C@@H]2C |
| InChI | InChI=1S/C23H27NO2/c1-3-26-22(25)19-14-23(19)15-20(17-10-6-4-7-11-17)24-21(16(23)2)18-12-8-5-9-13-18/h4-13,16,19-21,24H,3,14-15H2,1-2H3/t16-,19?,20-,21+,23?/m0/s1 |
| InChIKey | VTRYVONALYPYRT-OJTWQAEXSA-N |
| XLogP | 4.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |