C15H19NO3 — CID 102082926
ethyl (2S,4S,5R)-4-acetyl-5-phenylpyrrolidine-2-carboxylate (PubChem CID 102082926) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl (2S,4S,5R)-4-acetyl-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4S,5R)-4-acetyl-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102082926 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | ethyl (2S,4S,5R)-4-acetyl-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](C(C)=O)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C15H19NO3/c1-3-19-15(18)13-9-12(10(2)17)14(16-13)11-7-5-4-6-8-11/h4-8,12-14,16H,3,9H2,1-2H3/t12-,13+,14+/m1/s1 |
| InChIKey | KFFVSEUUMZHXGA-RDBSUJKOSA-N |
| XLogP | 1.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |