C13H15N3O3 — CID 142499073
ethyl 4-cyano-5-(6-oxo-1H-pyridin-3-yl)pyrrolidine-2-carboxylate (PubChem CID 142499073) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 4-cyano-5-(6-oxo-1H-pyridin-3-yl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-(6-oxo-1H-pyridin-3-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142499073 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethyl 4-cyano-5-(6-oxo-1H-pyridin-3-yl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CC(C#N)C(c2ccc(=O)[nH]c2)N1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-19-13(18)10-5-9(6-14)12(16-10)8-3-4-11(17)15-7-8/h3-4,7,9-10,12,16H,2,5H2,1H3,(H,15,17) |
| InChIKey | QKFFZTBKZVSGJM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |