C18H20N2O6 — CID 135014587
2-O-ethyl 3-O,4-O-dimethyl (2R,3R,4S,5S)-5-(4-cyanophenyl)pyrrolidine-2,3,4-tricarboxylate (PubChem CID 135014587) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl (2R,3R,4S,5S)-5-(4-cyanophenyl)pyrrolidine-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3R,4S,5S)-5-(4-cyanophenyl)pyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 135014587 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3R,4S,5S)-5-(4-cyanophenyl)pyrrolidine-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@H](c2ccc(C#N)cc2)[C@@H](C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H20N2O6/c1-4-26-18(23)15-13(17(22)25-3)12(16(21)24-2)14(20-15)11-7-5-10(9-19)6-8-11/h5-8,12-15,20H,4H2,1-3H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | OLPHZCYQPRWBAQ-GBJTYRQASA-N |
| XLogP | 0.71 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|