C22H22BrF2NO4 — CID 177452004
4-O-benzyl 2-O-ethyl (2R,3S,4S,5R)-3-[bromo(difluoro)methyl]-5-phenylpyrrolidine-2,4-dicarboxylate (PubChem CID 177452004) has the molecular formula C22H22BrF2NO4 and a molecular weight of 482.32 g/mol. Its IUPAC name is 4-O-benzyl 2-O-ethyl (2R,3S,4S,5R)-3-[bromo(difluoro)methyl]-5-phenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | 4-O-benzyl 2-O-ethyl (2R,3S,4S,5R)-3-[bromo(difluoro)methyl]-5-phenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 177452004 |
| Molecular Formula | C22H22BrF2NO4 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 4-O-benzyl 2-O-ethyl (2R,3S,4S,5R)-3-[bromo(difluoro)methyl]-5-phenylpyrrolidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@@H](c2ccccc2)[C@@H](C(=O)OCc2ccccc2)[C@@H]1C(F)(F)Br |
| InChI | InChI=1S/C22H22BrF2NO4/c1-2-29-21(28)19-17(22(23,24)25)16(18(26-19)15-11-7-4-8-12-15)20(27)30-13-14-9-5-3-6-10-14/h3-12,16-19,26H,2,13H2,1H3/t16-,17-,18-,19+/m0/s1 |
| InChIKey | XWQUYNRJHIRPCL-CADBVGFASA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|