C23H23NO2 — CID 101250588
ethyl (1R,3S,4R,7aR)-1,4-diphenyl-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate (PubChem CID 101250588) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl (1R,3S,4R,7aR)-1,4-diphenyl-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate.
| Compound Name | ethyl (1R,3S,4R,7aR)-1,4-diphenyl-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101250588 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | ethyl (1R,3S,4R,7aR)-1,4-diphenyl-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@@H](c2ccccc2)[C@@H]2C=CC=C2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c1-2-26-23(25)22-20(16-10-5-3-6-11-16)18-14-9-15-19(18)21(24-22)17-12-7-4-8-13-17/h3-15,19-22,24H,2H2,1H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | NYZQGXJZEGTPNI-CZYKHXBRSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |