C22H19F3N2O4 — CID 102495843
ethyl (1R,3S,3aR,6aS)-4,6-dioxo-5-phenyl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 102495843) has the molecular formula C22H19F3N2O4 and a molecular weight of 432.40 g/mol. Its IUPAC name is ethyl (1R,3S,3aR,6aS)-4,6-dioxo-5-phenyl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1R,3S,3aR,6aS)-4,6-dioxo-5-phenyl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102495843 |
| Molecular Formula | C22H19F3N2O4 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | ethyl (1R,3S,3aR,6aS)-4,6-dioxo-5-phenyl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@@H](c2ccc(C(F)(F)F)cc2)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C22H19F3N2O4/c1-2-31-21(30)18-16-15(19(28)27(20(16)29)14-6-4-3-5-7-14)17(26-18)12-8-10-13(11-9-12)22(23,24)25/h3-11,15-18,26H,2H2,1H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | RFTCFELDOLYWQL-MHORFTMASA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|