C21H24F3NO2 — CID 162539406
ethyl (1S,3R,4R,7aS)-4-propan-2-yl-1-[4-(trifluoromethyl)phenyl]-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate (PubChem CID 162539406) has the molecular formula C21H24F3NO2 and a molecular weight of 379.42 g/mol. Its IUPAC name is ethyl (1S,3R,4R,7aS)-4-propan-2-yl-1-[4-(trifluoromethyl)phenyl]-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate.
| Compound Name | ethyl (1S,3R,4R,7aS)-4-propan-2-yl-1-[4-(trifluoromethyl)phenyl]-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 162539406 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | ethyl (1S,3R,4R,7aS)-4-propan-2-yl-1-[4-(trifluoromethyl)phenyl]-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@H](c2ccc(C(F)(F)F)cc2)[C@H]2C=CC=C2[C@H]1C(C)C |
| InChI | InChI=1S/C21H24F3NO2/c1-4-27-20(26)19-17(12(2)3)15-6-5-7-16(15)18(25-19)13-8-10-14(11-9-13)21(22,23)24/h5-12,16-19,25H,4H2,1-3H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | XRUWHPAKDJJICC-WJFTUGDTSA-N |
| XLogP | 4.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |