C14H17F3N2O2 — CID 75132553
ethyl 4-methyl-5-[3-(trifluoromethyl)phenyl]pyrazolidine-3-carboxylate (PubChem CID 75132553) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is ethyl 4-methyl-5-[3-(trifluoromethyl)phenyl]pyrazolidine-3-carboxylate.
| Compound Name | ethyl 4-methyl-5-[3-(trifluoromethyl)phenyl]pyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 75132553 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | ethyl 4-methyl-5-[3-(trifluoromethyl)phenyl]pyrazolidine-3-carboxylate |
| SMILES | CCOC(=O)C1NNC(c2cccc(C(F)(F)F)c2)C1C |
| InChI | InChI=1S/C14H17F3N2O2/c1-3-21-13(20)12-8(2)11(18-19-12)9-5-4-6-10(7-9)14(15,16)17/h4-8,11-12,18-19H,3H2,1-2H3 |
| InChIKey | PWCJPMUSOGCZDX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |