C23H22ClNO2 — CID 101250590
ethyl (1R,3S,4R,7aR)-4-(4-chlorophenyl)-1-phenyl-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate (PubChem CID 101250590) has the molecular formula C23H22ClNO2 and a molecular weight of 379.89 g/mol. Its IUPAC name is ethyl (1R,3S,4R,7aR)-4-(4-chlorophenyl)-1-phenyl-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate.
| Compound Name | ethyl (1R,3S,4R,7aR)-4-(4-chlorophenyl)-1-phenyl-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101250590 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | ethyl (1R,3S,4R,7aR)-4-(4-chlorophenyl)-1-phenyl-2,3,4,7a-tetrahydro-1H-cyclopenta[c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@@H](c2ccccc2)[C@@H]2C=CC=C2[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClNO2/c1-2-27-23(26)22-20(15-11-13-17(24)14-12-15)18-9-6-10-19(18)21(25-22)16-7-4-3-5-8-16/h3-14,19-22,25H,2H2,1H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | XVSUSGODOINSCC-CZYKHXBRSA-N |
| XLogP | 4.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |