C26H24ClNO5S — CID 14923396
ethyl 6-(4-chlorobenzoyl)-1,1-dioxo-3,5-diphenyl-1,4-thiazinane-2-carboxylate (PubChem CID 14923396) has the molecular formula C26H24ClNO5S and a molecular weight of 498.00 g/mol. Its IUPAC name is ethyl 6-(4-chlorobenzoyl)-1,1-dioxo-3,5-diphenyl-1,4-thiazinane-2-carboxylate.
| Compound Name | ethyl 6-(4-chlorobenzoyl)-1,1-dioxo-3,5-diphenyl-1,4-thiazinane-2-carboxylate |
|---|---|
| PubChem CID | 14923396 |
| Molecular Formula | C26H24ClNO5S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | ethyl 6-(4-chlorobenzoyl)-1,1-dioxo-3,5-diphenyl-1,4-thiazinane-2-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)NC(c2ccccc2)C(C(=O)c2ccc(Cl)cc2)S1(=O)=O |
| InChI | InChI=1S/C26H24ClNO5S/c1-2-33-26(30)25-22(18-11-7-4-8-12-18)28-21(17-9-5-3-6-10-17)24(34(25,31)32)23(29)19-13-15-20(27)16-14-19/h3-16,21-22,24-25,28H,2H2,1H3 |
| InChIKey | GDEOGPMQIZOKBN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |