C14H15F3N2O4 — CID 15468539
ethyl (2S,4S,5S)-4-nitro-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate (PubChem CID 15468539) has the molecular formula C14H15F3N2O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is ethyl (2S,4S,5S)-4-nitro-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4S,5S)-4-nitro-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15468539 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | ethyl (2S,4S,5S)-4-nitro-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]([N+](=O)[O-])[C@H](c2ccc(C(F)(F)F)cc2)N1 |
| InChI | InChI=1S/C14H15F3N2O4/c1-2-23-13(20)10-7-11(19(21)22)12(18-10)8-3-5-9(6-4-8)14(15,16)17/h3-6,10-12,18H,2,7H2,1H3/t10-,11-,12-/m0/s1 |
| InChIKey | GJXOXLCLFNOAGW-SRVKXCTJSA-N |
| XLogP | 2.32 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|