C22H26F3NO5S — CID 168719729
ethyl (2R,5S)-5-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 168719729) has the molecular formula C22H26F3NO5S and a molecular weight of 473.51 g/mol. Its IUPAC name is ethyl (2R,5S)-5-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | ethyl (2R,5S)-5-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 168719729 |
| Molecular Formula | C22H26F3NO5S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | ethyl (2R,5S)-5-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](Cc2ccc(C(F)(F)F)cc2)N1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H18F3NO2.C7H8O3S/c1-2-21-14(20)13-8-7-12(19-13)9-10-3-5-11(6-4-10)15(16,17)18;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,12-13,19H,2,7-9H2,1H3;2-5H,1H3,(H,8,9,10)/t12-,13+;/m0./s1 |
| InChIKey | AQJWCSCDBOPABS-JHEYCYPBSA-N |
| XLogP | 4.17 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|