C21H26BrNO5S — CID 171338387
ethyl 5-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 171338387) has the molecular formula C21H26BrNO5S and a molecular weight of 484.41 g/mol. Its IUPAC name is ethyl 5-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | ethyl 5-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 171338387 |
| Molecular Formula | C21H26BrNO5S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | ethyl 5-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | CCOC(=O)C1CCC(Cc2ccc(Br)cc2)N1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H18BrNO2.C7H8O3S/c1-2-18-14(17)13-8-7-12(16-13)9-10-3-5-11(15)6-4-10;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,12-13,16H,2,7-9H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | UHYZSNIBEZWBQF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|