C16H18F3NO3 — CID 54076639
ethyl 3-[5-oxo-3-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]propanoate (PubChem CID 54076639) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is ethyl 3-[5-oxo-3-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]propanoate.
| Compound Name | ethyl 3-[5-oxo-3-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]propanoate |
|---|---|
| PubChem CID | 54076639 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethyl 3-[5-oxo-3-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]propanoate |
| SMILES | CCOC(=O)CCC1NC(=O)CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F3NO3/c1-2-23-15(22)8-7-13-12(9-14(21)20-13)10-3-5-11(6-4-10)16(17,18)19/h3-6,12-13H,2,7-9H2,1H3,(H,20,21) |
| InChIKey | MKEASGYGHQEINC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |