C14H14FNO4 — CID 11391819
ethyl (3S,4R)-4-(4-fluorophenyl)-2,6-dioxopiperidine-3-carboxylate (PubChem CID 11391819) has the molecular formula C14H14FNO4 and a molecular weight of 279.27 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(4-fluorophenyl)-2,6-dioxopiperidine-3-carboxylate.
| Compound Name | ethyl (3S,4R)-4-(4-fluorophenyl)-2,6-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 11391819 |
| Molecular Formula | C14H14FNO4 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | ethyl (3S,4R)-4-(4-fluorophenyl)-2,6-dioxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)NC(=O)C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FNO4/c1-2-20-14(19)12-10(7-11(17)16-13(12)18)8-3-5-9(15)6-4-8/h3-6,10,12H,2,7H2,1H3,(H,16,17,18)/t10-,12-/m0/s1 |
| InChIKey | TWTXBOKSRNPUQL-JQWIXIFHSA-N |
| XLogP | 1.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|