C15H17NO5 — CID 70454520
ethyl (3R,4S)-4-(2-methoxyphenyl)-2,6-dioxopiperidine-3-carboxylate (PubChem CID 70454520) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is ethyl (3R,4S)-4-(2-methoxyphenyl)-2,6-dioxopiperidine-3-carboxylate.
| Compound Name | ethyl (3R,4S)-4-(2-methoxyphenyl)-2,6-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 70454520 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | ethyl (3R,4S)-4-(2-methoxyphenyl)-2,6-dioxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)NC(=O)C[C@@H]1c1ccccc1OC |
| InChI | InChI=1S/C15H17NO5/c1-3-21-15(19)13-10(8-12(17)16-14(13)18)9-6-4-5-7-11(9)20-2/h4-7,10,13H,3,8H2,1-2H3,(H,16,17,18)/t10-,13-/m1/s1 |
| InChIKey | ZCJPNKQCRRSZDA-ZWNOBZJWSA-N |
| XLogP | 1.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|