C20H18F3NO3 — CID 54096854
phenyl 3-[5-oxo-3-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]propanoate (PubChem CID 54096854) has the molecular formula C20H18F3NO3 and a molecular weight of 377.36 g/mol. Its IUPAC name is phenyl 3-[5-oxo-3-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]propanoate.
| Compound Name | phenyl 3-[5-oxo-3-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]propanoate |
|---|---|
| PubChem CID | 54096854 |
| Molecular Formula | C20H18F3NO3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | phenyl 3-[5-oxo-3-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]propanoate |
| SMILES | O=C1CC(c2ccc(C(F)(F)F)cc2)C(CCC(=O)Oc2ccccc2)N1 |
| InChI | InChI=1S/C20H18F3NO3/c21-20(22,23)14-8-6-13(7-9-14)16-12-18(25)24-17(16)10-11-19(26)27-15-4-2-1-3-5-15/h1-9,16-17H,10-12H2,(H,24,25) |
| InChIKey | MXSGXYQIAGIBFZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|