C14H13F3O3 — CID 66867722
2-oxo-3-[2-[4-(trifluoromethyl)phenyl]cyclobutyl]propanoic acid (PubChem CID 66867722) has the molecular formula C14H13F3O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-oxo-3-[2-[4-(trifluoromethyl)phenyl]cyclobutyl]propanoic acid.
| Compound Name | 2-oxo-3-[2-[4-(trifluoromethyl)phenyl]cyclobutyl]propanoic acid |
|---|---|
| PubChem CID | 66867722 |
| Molecular Formula | C14H13F3O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-oxo-3-[2-[4-(trifluoromethyl)phenyl]cyclobutyl]propanoic acid |
| SMILES | O=C(O)C(=O)CC1CCC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3O3/c15-14(16,17)10-4-1-8(2-5-10)11-6-3-9(11)7-12(18)13(19)20/h1-2,4-5,9,11H,3,6-7H2,(H,19,20) |
| InChIKey | FLCBDIKZIAKMPW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|