About methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid
methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 159697418) has the molecular formula C13H15F3NO3-
and a molecular weight of 290.26 g/mol. Its IUPAC name is methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 159697418 |
| Molecular Formula | C13H15F3NO3- |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | COC[NH-].O=C(O)C1CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3O2.C2H6NO/c12-11(13,14)7-3-1-6(2-4-7)8-5-9(8)10(15)16;1-4-2-3/h1-4,8-9H,5H2,(H,15,16);3H,2H2,1H3/q;-1 |
| InChIKey | MXEOTKXPRSCBCE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid?
The IUPAC name of methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CID 159697418) is methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid is COC[NH-].O=C(O)C1CC1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid?
The InChIKey is MXEOTKXPRSCBCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3O2.C2H6NO/c12-11(13,14)7-3-1-6(2-4-7)8-5-9(8)10(15)16;1-4-2-3/h1-4,8-9H,5H2,(H,15,16);3H,2H2,1H3/q;-1.
What are the key properties of methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid?
methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid has a molecular weight of 290.26 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 159697418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).