C13H15F3NO3- — CID 159697418
methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 159697418) has the molecular formula C13H15F3NO3- and a molecular weight of 290.26 g/mol. Its IUPAC name is methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 159697418 |
| Molecular Formula | C13H15F3NO3- |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methoxymethylazanide;2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | COC[NH-].O=C(O)C1CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3O2.C2H6NO/c12-11(13,14)7-3-1-6(2-4-7)8-5-9(8)10(15)16;1-4-2-3/h1-4,8-9H,5H2,(H,15,16);3H,2H2,1H3/q;-1 |
| InChIKey | MXEOTKXPRSCBCE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |