C12H11F3O — CID 93025354
1-[(1R,2R)-2-[4-(trifluoromethyl)phenyl]cyclopropyl]ethanone (PubChem CID 93025354) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is 1-[(1R,2R)-2-[4-(trifluoromethyl)phenyl]cyclopropyl]ethanone.
| Compound Name | 1-[(1R,2R)-2-[4-(trifluoromethyl)phenyl]cyclopropyl]ethanone |
|---|---|
| PubChem CID | 93025354 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-[(1R,2R)-2-[4-(trifluoromethyl)phenyl]cyclopropyl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3O/c1-7(16)10-6-11(10)8-2-4-9(5-3-8)12(13,14)15/h2-5,10-11H,6H2,1H3/t10-,11-/m0/s1 |
| InChIKey | FPALMPWCQWTJSW-QWRGUYRKSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |